CAS 1346608-64-7 appears in our catalog under these names: 1-Methyl-1h-pyrrolo[3,2-b]pyridine-3-carboxylic acid, 97%, 1–Methyl–1H–pyrrolo(3,2–b)pyridine–3–carboxylic acid, 1-Methyl-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 250mg, 50mg.
1-methylpyrrolo[3,2-b]pyridine-3-carboxylic acid (CAS 1346608-64-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylpyrrolo[3,2-b]pyridine-3-carboxylic acid. InChIKey: OOWDXELTICDUGT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylpyrrolo[3,2-b]pyridine-3-carboxylic acid |
| InChIKey | OOWDXELTICDUGT-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C1C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)