CAS 13480-38-1 appears in our catalog under these names: 2-Methyl-5-nitrobiphenyl, 95%, 4–Nitro–2–phenyltoluene. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-methyl-4-nitro-2-phenylbenzene (CAS 13480-38-1) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 1-methyl-4-nitro-2-phenylbenzene. InChIKey: URKOXRGLMICDRL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 1-methyl-4-nitro-2-phenylbenzene |
| InChIKey | URKOXRGLMICDRL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)