Products 1349717-93-6
CAS 1349717-93-6 is the registry number for 2,4-difluoro-3-methylbenzene-1-sulfonyl chloride, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-difluoro-3-methylbenzenesulfonyl chloride (CAS 1349717-93-6) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: 2,4-difluoro-3-methylbenzenesulfonyl chloride. InChIKey: QIXBRAHDJLFTRQ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | 2,4-difluoro-3-methylbenzenesulfonyl chloride |
| InChIKey | QIXBRAHDJLFTRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)