CAS 134997-87-8 appears in our catalog under these names: 3-Oxo-3,4-dihydro-2H-benzo(b)(1,4)oxazine-6-carboxylic Acid, 3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carboxylic acid, 97%, 97%, 3-Oxo-3,4-dihydro-2H-1,4-benzoxazine-6-carboxylic acid, 97%, 3-Oxo-3,4-dihydro-2H-benzo[b][1,4]oxazine-6-carboxylic acid, 95%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 500mg, 50mg, 25g, 250mg, 1g, 5g, 10g.
3-oxo-4H-1,4-benzoxazine-6-carboxylic acid (CAS 134997-87-8) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid. InChIKey: CIYUDMUBYRVMLP-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-oxo-4H-1,4-benzoxazine-6-carboxylic acid |
| InChIKey | CIYUDMUBYRVMLP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)