CAS 1803590-83-1 appears in our catalog under these names: Imidazo(1,2-a)pyrimidin-6-ylmethanamine dihydrochloride, 98%, {Imidazo(1,2-a)pyrimidin-6-yl}methanamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Imidazo[1,2-a]pyrimidin-6-ylmethanamine;dihydrochloride (CAS 1803590-83-1) is a chemical compound with the molecular formula C7H10Cl2N4 and a molecular weight of 221.08 g/mol. IUPAC name: imidazo[1,2-a]pyrimidin-6-ylmethanamine;dihydrochloride. InChIKey: NIYGJTCLHBHJBR-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N4 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | imidazo[1,2-a]pyrimidin-6-ylmethanamine;dihydrochloride |
| InChIKey | NIYGJTCLHBHJBR-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=NC2=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)