CAS 1354225-89-0 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-3,3,3-trifluoropropanoic acid, 95%, (R)–2–((tert–Butoxycarbonyl)amino)–3,3,3–trifluoropropanoic acid, (R)-2-((tert-Butoxycarbonyl)amino)-3,3,3-trifluoropropanoic acid. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
(2R)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1354225-89-0) is a chemical compound with the molecular formula C8H12F3NO4 and a molecular weight of 243.18 g/mol. IUPAC name: (2R)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DRKWWMGEXDHBSK-SCSAIBSYSA-N.
| Molecular formula | C8H12F3NO4 |
|---|---|
| Molecular weight | 243.18 g/mol |
| IUPAC name | (2R)-3,3,3-trifluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DRKWWMGEXDHBSK-SCSAIBSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)