CAS 1354801-06-1 is the registry number for 6,7,8,9–Tetrahydro–5H–pyrrolo(2,3–b:5,4–c')dipyridine hydrochloride. Offered by: GLPBio. Available pack sizes: 50mg.
5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene;hydrochloride (CAS 1354801-06-1) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene;hydrochloride. InChIKey: JMGYEDDZIZBCSJ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene;hydrochloride |
| InChIKey | JMGYEDDZIZBCSJ-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C3=C(N2)N=CC=C3.Cl |
Computed by PubChem (NCBI)