Products 1354950-07-4
CAS 1354950-07-4 is the registry number for Cyclopropyl(2,4-difluorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cyclopropyl-(2,4-difluorophenyl)methanamine;hydrochloride (CAS 1354950-07-4) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: cyclopropyl-(2,4-difluorophenyl)methanamine;hydrochloride. InChIKey: MAZJOGNMEIGXJF-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | cyclopropyl-(2,4-difluorophenyl)methanamine;hydrochloride |
| InChIKey | MAZJOGNMEIGXJF-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=C(C=C2)F)F)N.Cl |
Computed by PubChem (NCBI)