CAS 1354952-02-5 appears in our catalog under these names: Methyl 3-(4-methyl-1,3-thiazol-2-yl)benzoate, 95%, Methyl 3-(4-methyl-1,3-thiazol-2-yl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Methyl 3-(4-methyl-1,3-thiazol-2-yl)benzoate (CAS 1354952-02-5) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: methyl 3-(4-methyl-1,3-thiazol-2-yl)benzoate. InChIKey: OWKUDSAXXSXSKN-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | methyl 3-(4-methyl-1,3-thiazol-2-yl)benzoate |
| InChIKey | OWKUDSAXXSXSKN-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)