CAS 1354961-74-2 appears in our catalog under these names: 3-((2,6-Difluorophenyl)methyl)azetidine hydrochloride, 98%, 3-((2,6-Difluorophenyl)methyl)azetidine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
3-[(2,6-difluorophenyl)methyl]azetidine;hydrochloride (CAS 1354961-74-2) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: 3-[(2,6-difluorophenyl)methyl]azetidine;hydrochloride. InChIKey: WTYJHKPVOGTJRF-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 3-[(2,6-difluorophenyl)methyl]azetidine;hydrochloride |
| InChIKey | WTYJHKPVOGTJRF-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CC2=C(C=CC=C2F)F.Cl |
Computed by PubChem (NCBI)