Products 1355224-53-1
CAS 1355224-53-1 is the registry number for 3,6-Dichloro-1-methyl-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,6-dichloro-1-methylindole-2-carboxylic acid (CAS 1355224-53-1) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 3,6-dichloro-1-methylindole-2-carboxylic acid. InChIKey: YSUPLOUZDIDDBE-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 3,6-dichloro-1-methylindole-2-carboxylic acid |
| InChIKey | YSUPLOUZDIDDBE-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Cl)C(=C1C(=O)O)Cl |
Computed by PubChem (NCBI)