Products 1447606-34-9
CAS 1447606-34-9 appears in our catalog under these names: 3-(2,6-Dichlorophenyl)-3-cyanopropanoic acid, 95%, 3-Cyano-3-(2,6-dichlorophenyl)propanoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-cyano-3-(2,6-dichlorophenyl)propanoic acid (CAS 1447606-34-9) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 3-cyano-3-(2,6-dichlorophenyl)propanoic acid. InChIKey: IRWHUIXGTIEHQD-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 3-cyano-3-(2,6-dichlorophenyl)propanoic acid |
| InChIKey | IRWHUIXGTIEHQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(CC(=O)O)C#N)Cl |
Computed by PubChem (NCBI)