Products 2091080-07-6
CAS 2091080-07-6 is the registry number for 5,6-Dichloro-1-methyl-1H-indole-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dichloro-1-methylindole-3-carboxylic acid (CAS 2091080-07-6) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 5,6-dichloro-1-methylindole-3-carboxylic acid. InChIKey: INVLNWILKDPURB-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 5,6-dichloro-1-methylindole-3-carboxylic acid |
| InChIKey | INVLNWILKDPURB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC(=C(C=C21)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)