CAS 223671-54-3 appears in our catalog under these names: 1-Chloroisoquinoline-7-carboxylic acid, 95%, 1-Chloroisoquinoline-7-carboxylic acid hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
1-chloroisoquinoline-7-carboxylic acid;hydrochloride (CAS 223671-54-3) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: 1-chloroisoquinoline-7-carboxylic acid;hydrochloride. InChIKey: MRIRNGJIZUGYSW-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | 1-chloroisoquinoline-7-carboxylic acid;hydrochloride |
| InChIKey | MRIRNGJIZUGYSW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN=C2Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)