CAS 849589-04-4 is the registry number for Methyl 2-cyano-2-(3,4-dichlorophenyl)acetate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-cyano-2-(3,4-dichlorophenyl)acetate (CAS 849589-04-4) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: methyl 2-cyano-2-(3,4-dichlorophenyl)acetate. InChIKey: XURZHUOKWKYITK-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | methyl 2-cyano-2-(3,4-dichlorophenyl)acetate |
| InChIKey | XURZHUOKWKYITK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)