CAS 957062-73-6 is the registry number for (5-(2,4-Dichlorophenyl)oxazol-4-yl)methanol, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[5-(2,4-dichlorophenyl)-1,3-oxazol-4-yl]methanol (CAS 957062-73-6) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: [5-(2,4-dichlorophenyl)-1,3-oxazol-4-yl]methanol. InChIKey: XWBSXYDCPBBFEK-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | [5-(2,4-dichlorophenyl)-1,3-oxazol-4-yl]methanol |
| InChIKey | XWBSXYDCPBBFEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=C(N=CO2)CO |
Computed by PubChem (NCBI)