CAS 338776-95-7 appears in our catalog under these names: (5-(3,4-Dichlorophenyl)-1,2-oxazol-3-yl)methanol, 98%, (5-(3,4-Dichlorophenyl)isoxazol-3-yl)methanol, 98%, 98%, 3-Isoxazolemethanol, 5-(3,4-dichlorophenyl)-, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
[5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol (CAS 338776-95-7) is a chemical compound with the molecular formula C10H7Cl2NO2 and a molecular weight of 244.07 g/mol. IUPAC name: [5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol. InChIKey: XDHFBKUYZJPSFQ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | [5-(3,4-dichlorophenyl)-1,2-oxazol-3-yl]methanol |
| InChIKey | XDHFBKUYZJPSFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=NO2)CO)Cl)Cl |
Computed by PubChem (NCBI)