Products 1355247-96-9
CAS 1355247-96-9 is the registry number for 4-(2-Acetylphenyl)-2-chlorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(2-acetylphenyl)-2-chlorobenzoic acid (CAS 1355247-96-9) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: 4-(2-acetylphenyl)-2-chlorobenzoic acid. InChIKey: OJORRYBFKFJYGU-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 4-(2-acetylphenyl)-2-chlorobenzoic acid |
| InChIKey | OJORRYBFKFJYGU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1C2=CC(=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)