CAS 164526-07-2 is the registry number for 6-(2-Chlorobenzoyl)-2,3-dihydro-1,4-benzodioxine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(2-chlorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (CAS 164526-07-2) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: (2-chlorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone. InChIKey: ZYMLUQLZIRHDPQ-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| InChIKey | ZYMLUQLZIRHDPQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)