CAS 5067-25-4 appears in our catalog under these names: 1-(5-Chloro-2-hydroxyphenyl)-3-phenylpropane-1,3-dione, 98%, ST026567. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
1-(5-chloro-2-hydroxyphenyl)-3-phenylpropane-1,3-dione (CAS 5067-25-4) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: 1-(5-chloro-2-hydroxyphenyl)-3-phenylpropane-1,3-dione. InChIKey: VOVLKGWYQQCQHB-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 1-(5-chloro-2-hydroxyphenyl)-3-phenylpropane-1,3-dione |
| InChIKey | VOVLKGWYQQCQHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)