CAS 148960-78-5 is the registry number for Azelastine Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(3-chlorophenyl)acetyl]benzoic acid (CAS 148960-78-5) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: 2-[2-(3-chlorophenyl)acetyl]benzoic acid. InChIKey: GYOXJJWXTVQEAB-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 2-[2-(3-chlorophenyl)acetyl]benzoic acid |
| InChIKey | GYOXJJWXTVQEAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)