Products 148960-78-5

CAS 148960-78-5 is the registry number for Azelastine Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[2-(3-chlorophenyl)acetyl]benzoic acid (CAS 148960-78-5) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: 2-[2-(3-chlorophenyl)acetyl]benzoic acid. InChIKey: GYOXJJWXTVQEAB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11ClO3
Molecular weight274.70 g/mol
IUPAC name2-[2-(3-chlorophenyl)acetyl]benzoic acid
InChIKeyGYOXJJWXTVQEAB-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)CC2=CC(=CC=C2)Cl)C(=O)O

Computed by PubChem (NCBI)