Products 2536-31-4
CAS 2536-31-4 appears in our catalog under these names: Chlorflurenol-methyl, Chlorflurenol-methyl (Technical Grade), Chlorflurenol-methyl ester, Chlorflurenol-methyl ester, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 100mg, 250mg, 25mg, 1x250mg, 1x1ml.
Methyl 2-chloro-9-hydroxyfluorene-9-carboxylate (CAS 2536-31-4) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: methyl 2-chloro-9-hydroxyfluorene-9-carboxylate. InChIKey: LINPVWIEWJTEEJ-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | methyl 2-chloro-9-hydroxyfluorene-9-carboxylate |
| InChIKey | LINPVWIEWJTEEJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(C2=CC=CC=C2C3=C1C=C(C=C3)Cl)O |
Computed by PubChem (NCBI)