CAS 58249-87-9 is the registry number for 2-(Benzoyloxymethyl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-carbonochloridoylphenyl)methyl benzoate (CAS 58249-87-9) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: (2-carbonochloridoylphenyl)methyl benzoate. InChIKey: UDEQFYWNFHWPRH-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | (2-carbonochloridoylphenyl)methyl benzoate |
| InChIKey | UDEQFYWNFHWPRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2=CC=CC=C2C(=O)Cl |
Computed by PubChem (NCBI)