CAS 27500-82-9 appears in our catalog under these names: 4-(Chloromethyl)-3-methoxy-9h-xanthen-9-one, 95%, 4–(Chloromethyl)–3–methoxy–9H–xanthen–9–one. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4-(chloromethyl)-3-methoxyxanthen-9-one (CAS 27500-82-9) is a chemical compound with the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. IUPAC name: 4-(chloromethyl)-3-methoxyxanthen-9-one. InChIKey: HIPJVGGQFBOFQJ-UHFFFAOYSA-N.
| Molecular formula | C15H11ClO3 |
|---|---|
| Molecular weight | 274.70 g/mol |
| IUPAC name | 4-(chloromethyl)-3-methoxyxanthen-9-one |
| InChIKey | HIPJVGGQFBOFQJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3O2)CCl |
Computed by PubChem (NCBI)