Products 2287299-36-7
CAS 2287299-36-7 is the registry number for 7-Chloro-4-hydrazinylquinazoline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(7-chloroquinazolin-4-yl)hydrazine;hydrochloride (CAS 2287299-36-7) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: (7-chloroquinazolin-4-yl)hydrazine;hydrochloride. InChIKey: HJJFLLHZPJZIBY-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | (7-chloroquinazolin-4-yl)hydrazine;hydrochloride |
| InChIKey | HJJFLLHZPJZIBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=CN=C2NN.Cl |
Computed by PubChem (NCBI)