CAS 953018-13-8 is the registry number for 2,6-Dichloro-7-isopropylpurine. Offered by: Biosynth. Available pack sizes: 1g, 0,5g.
2,6-dichloro-7-propan-2-ylpurine (CAS 953018-13-8) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 2,6-dichloro-7-propan-2-ylpurine. InChIKey: BMKLSAIGMUTOQX-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 2,6-dichloro-7-propan-2-ylpurine |
| InChIKey | BMKLSAIGMUTOQX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)