Products 1958076-30-6
CAS 1958076-30-6 is the registry number for NPFFR2 modulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine (CAS 1958076-30-6) is a chemical compound with the molecular formula C8H8Cl2N4 and a molecular weight of 231.08 g/mol. IUPAC name: 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine. InChIKey: QITKCQWRUKVTKJ-YIXHJXPBSA-N.
| Molecular formula | C8H8Cl2N4 |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | 2-[(E)-(3,4-dichlorophenyl)methylideneamino]guanidine |
| InChIKey | QITKCQWRUKVTKJ-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/N=C(N)N)Cl)Cl |
Computed by PubChem (NCBI)