Products 1357838-47-1
CAS 1357838-47-1 appears in our catalog under these names: 6-(4-Methylpentyl)-2-naphthalenecarboxylic acid, 95%, 95%, UBP684. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, Get quote.
6-(4-methylpentyl)naphthalene-2-carboxylic acid (CAS 1357838-47-1) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 6-(4-methylpentyl)naphthalene-2-carboxylic acid. InChIKey: ZQLORCYRMVILSV-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 6-(4-methylpentyl)naphthalene-2-carboxylic acid |
| InChIKey | ZQLORCYRMVILSV-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC1=CC2=C(C=C1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)