CAS 135906-00-2 is the registry number for 1-Cyclohexyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 97% . Offered by: Thermo Scientific. Available pack sizes: 1g, 10g.
1-cyclohexyl-4-oxoquinoline-3-carboxylic acid (CAS 135906-00-2) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: 1-cyclohexyl-4-oxoquinoline-3-carboxylic acid. InChIKey: DTLUKEHVTWNAGE-UHFFFAOYSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-cyclohexyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | DTLUKEHVTWNAGE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2C=C(C(=O)C3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)