CAS 135944-09-1 appears in our catalog under these names: Fmoc–D–Homophe–OH, Fmoc-D-HPhe-OH, Fmoc-D-HoPhe-OH 97%, Fmoc-D-HoPhe-OH, 97%, 97%, Fmoc-D-HoPhe-OH, 99.97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10g, 100g, 25g, 5g, 250mg, 1g, 25 g, 10 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid (CAS 135944-09-1) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid. InChIKey: CIHPCIUGLIZADU-HSZRJFAPSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid |
| InChIKey | CIHPCIUGLIZADU-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)