Products 186320-01-4

CAS 186320-01-4 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-4-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid (CAS 186320-01-4) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid. InChIKey: CIHPCIUGLIZADU-UHFFFAOYSA-N.

Identity
Molecular formulaC25H23NO4
Molecular weight401.5 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid
InChIKeyCIHPCIUGLIZADU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)