CAS 1359828-98-0 appears in our catalog under these names: Ethyl 2,3-difluoroisonicotinate, 98%, 98%, Ethyl 2,3-difluoropyridine-4-carboxylate, 98%. Offered by: Chemat, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Ethyl 2,3-difluoropyridine-4-carboxylate (CAS 1359828-98-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: ethyl 2,3-difluoropyridine-4-carboxylate. InChIKey: AOJMSQNOPRKCOZ-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | ethyl 2,3-difluoropyridine-4-carboxylate |
| InChIKey | AOJMSQNOPRKCOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=NC=C1)F)F |
Computed by PubChem (NCBI)