Products 1360886-35-6
CAS 1360886-35-6 is the registry number for 7-Bromo-1H-indole-4-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-1H-indole-4-carboxylic acid (CAS 1360886-35-6) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 7-bromo-1H-indole-4-carboxylic acid. InChIKey: JRDFMAXJWUPBNT-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 7-bromo-1H-indole-4-carboxylic acid |
| InChIKey | JRDFMAXJWUPBNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1C(=O)O)C=CN2)Br |
Computed by PubChem (NCBI)
Synonyms:
7-bromo-1H-indole-4-carboxylic acid