Products 1360927-57-6
CAS 1360927-57-6 appears in our catalog under these names: 5-Methyl-1h-indazole-4-carboxylic acid, 95%, 5–Methyl–1H–indazole–4–carboxylic acid, 5-Methyl-1H-indazole-4-carboxylic acid 97%, 5-Methyl-1H-indazole-4-carboxylic acid, 97%, 97%, 5-METHYL-1H-INDAZOLE-4-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 50mg.
5-methyl-1H-indazole-4-carboxylic acid (CAS 1360927-57-6) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-methyl-1H-indazole-4-carboxylic acid. InChIKey: BSZNJJXTCSVIAT-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-methyl-1H-indazole-4-carboxylic acid |
| InChIKey | BSZNJJXTCSVIAT-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NN=C2)C(=O)O |
Computed by PubChem (NCBI)