Products 1360928-68-2
CAS 1360928-68-2 is the registry number for 7-Bromo-3,3-difluoroindolin-2-one, 97%. Offered by: AmBeed. Available pack sizes: 1g.
7-bromo-3,3-difluoro-1H-indol-2-one (CAS 1360928-68-2) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 7-bromo-3,3-difluoro-1H-indol-2-one. InChIKey: IXGUJVXGMIRFIW-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 7-bromo-3,3-difluoro-1H-indol-2-one |
| InChIKey | IXGUJVXGMIRFIW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=O)C2(F)F |
Computed by PubChem (NCBI)