CAS 1393532-37-0 appears in our catalog under these names: 6-Bromo-3,3-difluoro-1,3-dihydro-2h-indol-2-one, 95%, 6-Bromo-3,3-difluoroindolin-2-one, 97%, 6-bromo-3,3-difluoroindolin-2-one, 6-bromo-3,3-difluoro-2,3-dihydro-1H-indol-2-one, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 0,5g, 50mg, 100mg, 500mg.
6-bromo-3,3-difluoro-1H-indol-2-one (CAS 1393532-37-0) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 6-bromo-3,3-difluoro-1H-indol-2-one. InChIKey: KKRAAULUIAIYBS-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 6-bromo-3,3-difluoro-1H-indol-2-one |
| InChIKey | KKRAAULUIAIYBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)C2(F)F |
Computed by PubChem (NCBI)