CAS 552332-19-1 appears in our catalog under these names: 5-Bromo-3,3-difluoro-2,3-dihydro-1h-indol-2-one, 95%, 5-Bromo-3,3-difluoro-2,3-dihydro-1H-indol-2-one, 5-Bromo-3,3-difluoroindolin-2-one 95%, 5-Bromo-3,3-Difluoroindolin-2-One, 95%, 95%, 5-Bromo-3,3-difluoro-2,3-dihydro-1H-indol-2-one, >97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
5-bromo-3,3-difluoro-1H-indol-2-one (CAS 552332-19-1) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 5-bromo-3,3-difluoro-1H-indol-2-one. InChIKey: NQVFCXSWOMDLAY-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 5-bromo-3,3-difluoro-1H-indol-2-one |
| InChIKey | NQVFCXSWOMDLAY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(C(=O)N2)(F)F |
Computed by PubChem (NCBI)