CAS 2707534-33-4 is the registry number for 6-Bromo-4,5-difluoro-1,3-dihydroindol-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-bromo-4,5-difluoro-1,3-dihydroindol-2-one (CAS 2707534-33-4) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 6-bromo-4,5-difluoro-1,3-dihydroindol-2-one. InChIKey: HLTTUBQAVHYKBX-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 6-bromo-4,5-difluoro-1,3-dihydroindol-2-one |
| InChIKey | HLTTUBQAVHYKBX-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=C(C=C2NC1=O)Br)F)F |
Computed by PubChem (NCBI)