CAS 1857381-07-7 appears in our catalog under these names: 5-Bromo-4,6-difluoro-2,3-dihydro-1h-indol-2-one, 95%, 5-Bromo-4,6-difluoroindolin-2-one, 97%, 5-bromo-4,6-difluoro-2,3-dihydro-1H-indol-2-one, 97%, 97%, 5-bromo-4,6-difluoro-2,3-dihydro-1H-indol-2-one, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 100mg, 500mg, 1g.
5-bromo-4,6-difluoro-1,3-dihydroindol-2-one (CAS 1857381-07-7) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 5-bromo-4,6-difluoro-1,3-dihydroindol-2-one. InChIKey: ITRAJOLJFWRBGU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 5-bromo-4,6-difluoro-1,3-dihydroindol-2-one |
| InChIKey | ITRAJOLJFWRBGU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=C(C=C2NC1=O)F)Br)F |
Computed by PubChem (NCBI)