Products 2916881-10-0
CAS 2916881-10-0 is the registry number for 6-Bromo-4-fluoro-2-(fluoromethyl)benzo[d]oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-fluoro-2-(fluoromethyl)-1,3-benzoxazole (CAS 2916881-10-0) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 6-bromo-4-fluoro-2-(fluoromethyl)-1,3-benzoxazole. InChIKey: DTWHOFUYKGNSOG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 6-bromo-4-fluoro-2-(fluoromethyl)-1,3-benzoxazole |
| InChIKey | DTWHOFUYKGNSOG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1OC(=N2)CF)F)Br |
Computed by PubChem (NCBI)