Products 1379301-44-6
CAS 1379301-44-6 is the registry number for 2-(4-Bromo-2,5-difluoro-phenoxy)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(4-bromo-2,5-difluorophenoxy)acetonitrile (CAS 1379301-44-6) is a chemical compound with the molecular formula C8H4BrF2NO and a molecular weight of 248.02 g/mol. IUPAC name: 2-(4-bromo-2,5-difluorophenoxy)acetonitrile. InChIKey: GAPMBTCSUWWWDI-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2NO |
|---|---|
| Molecular weight | 248.02 g/mol |
| IUPAC name | 2-(4-bromo-2,5-difluorophenoxy)acetonitrile |
| InChIKey | GAPMBTCSUWWWDI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)OCC#N |
Computed by PubChem (NCBI)