CAS 1360958-33-3 appears in our catalog under these names: 5-Bromo-4-fluoro-1H-indazole-3-carboxylic acid, 97%, 5-bromo-4-fluoro-1H-indazole-3-carboxylic acid, 95%, 95%, 5-BROMO-4-FLUORO-1H-INDAZOLE-3-CARBOXYLIC ACID, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
5-bromo-4-fluoro-1H-indazole-3-carboxylic acid (CAS 1360958-33-3) is a chemical compound with the molecular formula C8H4BrFN2O2 and a molecular weight of 259.03 g/mol. IUPAC name: 5-bromo-4-fluoro-1H-indazole-3-carboxylic acid. InChIKey: ONQIIBMSLCRMBF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2O2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | 5-bromo-4-fluoro-1H-indazole-3-carboxylic acid |
| InChIKey | ONQIIBMSLCRMBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2C(=O)O)F)Br |
Computed by PubChem (NCBI)