CAS 1363382-93-7 appears in our catalog under these names: 3-Methyl-7-azaindole-5-carboxylic acid, 95%, 3-Methyl-7-azaindole-5-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid (CAS 1363382-93-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid. InChIKey: WZWMYWSNNVONBA-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylic acid |
| InChIKey | WZWMYWSNNVONBA-UHFFFAOYSA-N |
| SMILES | CC1=CNC2=C1C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)