Products 1365091-92-4
CAS 1365091-92-4 is the registry number for 1-(2,5-Dichloro-3-fluorophenyl)ethanone, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
1-(2,5-dichloro-3-fluorophenyl)ethanone (CAS 1365091-92-4) is a chemical compound with the molecular formula C8H5Cl2FO and a molecular weight of 207.03 g/mol. IUPAC name: 1-(2,5-dichloro-3-fluorophenyl)ethanone. InChIKey: BNVNJBLICKNSGA-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO |
|---|---|
| Molecular weight | 207.03 g/mol |
| IUPAC name | 1-(2,5-dichloro-3-fluorophenyl)ethanone |
| InChIKey | BNVNJBLICKNSGA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Cl)F)Cl |
Computed by PubChem (NCBI)