CAS 136539-67-8 is the registry number for 3-(3-Nitrophenyl)phenol, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-(3-nitrophenyl)phenol (CAS 136539-67-8) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 3-(3-nitrophenyl)phenol. InChIKey: WNJTYKRGWYTCCZ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 3-(3-nitrophenyl)phenol |
| InChIKey | WNJTYKRGWYTCCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)