CAS 136561-53-0 appears in our catalog under these names: (2R,3S)-3-Phenylisoserine, 95%, (2R,3S)–3–Phenylisoserine, 3-(2R,3S)-Phenylisoserine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 50mg.
(2R,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid (CAS 136561-53-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid. InChIKey: RZARFIRJROUVLM-JGVFFNPUSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid |
| InChIKey | RZARFIRJROUVLM-JGVFFNPUSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C(=O)O)O)N |
Computed by PubChem (NCBI)