CAS 55325-50-3 is the registry number for (2R,3R)-3-Amino-2-hydroxy-3-phenylpropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
(2R,3R)-3-amino-2-hydroxy-3-phenylpropanoic acid (CAS 55325-50-3) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (2R,3R)-3-amino-2-hydroxy-3-phenylpropanoic acid. InChIKey: RZARFIRJROUVLM-HTQZYQBOSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (2R,3R)-3-amino-2-hydroxy-3-phenylpropanoic acid |
| InChIKey | RZARFIRJROUVLM-HTQZYQBOSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@H](C(=O)O)O)N |
Computed by PubChem (NCBI)