Products 136649-27-9
CAS 136649-27-9 appears in our catalog under these names: 5-Bromo-[1,1'-biphenyl]-3-amine, 98%, 98%, 5-Bromo-[1,1'-biphenyl]-3-amine, 98%, 5-Bromo-[1,1'-biphenyl]-3-amine, 95%, 5-Bromo-[1，1'-biphenyl]-3-amine, 98%. Offered by: Chemat, Ambeed, Fluorochem, BLDpharm. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g.
3-bromo-5-phenylaniline (CAS 136649-27-9) is a chemical compound with the molecular formula C12H10BrN and a molecular weight of 248.12 g/mol. IUPAC name: 3-bromo-5-phenylaniline. InChIKey: GVXORPLABCGSHA-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN |
|---|---|
| Molecular weight | 248.12 g/mol |
| IUPAC name | 3-bromo-5-phenylaniline |
| InChIKey | GVXORPLABCGSHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Br)N |
Computed by PubChem (NCBI)
Synonyms:
5-Bromo-[1,1'-biphenyl]-3-amine, 3-Bromo-5-phenylaniline, 5-Bromo[1,1'-biphenyl]-3-amine, [1,1'-Biphenyl]-3-amine, 5-bromo-, 5-bromobiphenyl-3-amine, 3-bromo-5-phenyl-aniline, 5-Bromo-[1,1-biphenyl]-3-amine, 5-Bromo-[11'-biphenyl]-3-amine, 1,1'-Biphenyl]-3-amine, 5-bromo-, 5-Bromo-[1,1 inverted exclamation mark -biphenyl]-3-amine