Products 1367947-69-0

CAS 1367947-69-0 is the registry number for 5H,6H,8H-Pyrano(3,4-b)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carboxylic acid (CAS 1367947-69-0) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carboxylic acid. InChIKey: BAQDKPQTVHVUNL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO3
Molecular weight179.17 g/mol
IUPAC name6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carboxylic acid
InChIKeyBAQDKPQTVHVUNL-UHFFFAOYSA-N
SMILESC1COCC2=C1C=C(C=N2)C(=O)O

Computed by PubChem (NCBI)