Products 1368069-92-4
CAS 1368069-92-4 is the registry number for 5-Methoxyfuro(3,2-b)pyridine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-methoxyfuro[3,2-b]pyridine-2-carboxylic acid (CAS 1368069-92-4) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 5-methoxyfuro[3,2-b]pyridine-2-carboxylic acid. InChIKey: ULINLNOTKRQAFX-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-methoxyfuro[3,2-b]pyridine-2-carboxylic acid |
| InChIKey | ULINLNOTKRQAFX-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)OC(=C2)C(=O)O |
Computed by PubChem (NCBI)